About 4-methyl-6-[2-[(E)-prop-1-enyl]phenyl]-1,2-dihydropyridine
4-methyl-6-[2-[(E)-prop-1-enyl]phenyl]-1,2-dihydropyridine (PubChem CID 129276692) has the molecular formula C15H17N
and a molecular weight of 211.31 g/mol. Its IUPAC name is 4-methyl-6-[2-[(E)-prop-1-enyl]phenyl]-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 4-methyl-6-[2-[(E)-prop-1-enyl]phenyl]-1,2-dihydropyridine |
| PubChem CID | 129276692 |
| Molecular Formula | C15H17N |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 4-methyl-6-[2-[(E)-prop-1-enyl]phenyl]-1,2-dihydropyridine |
| SMILES | C/C=C/c1ccccc1C1=CC(C)=CCN1 |
| InChI | InChI=1S/C15H17N/c1-3-6-13-7-4-5-8-14(13)15-11-12(2)9-10-16-15/h3-9,11,16H,10H2,1-2H3/b6-3+ |
| InChIKey | YQVOMPWHCMEKEZ-ZZXKWVIFSA-N |
| XLogP | 3.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methyl-6-[2-[(E)-prop-1-enyl]phenyl]-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-6-[2-[(E)-prop-1-enyl]phenyl]-1,2-dihydropyridine?
The IUPAC name of 4-methyl-6-[2-[(E)-prop-1-enyl]phenyl]-1,2-dihydropyridine (CID 129276692) is 4-methyl-6-[2-[(E)-prop-1-enyl]phenyl]-1,2-dihydropyridine.
What is the SMILES notation for 4-methyl-6-[2-[(E)-prop-1-enyl]phenyl]-1,2-dihydropyridine?
The canonical SMILES for 4-methyl-6-[2-[(E)-prop-1-enyl]phenyl]-1,2-dihydropyridine is C/C=C/c1ccccc1C1=CC(C)=CCN1.
What is the InChIKey of 4-methyl-6-[2-[(E)-prop-1-enyl]phenyl]-1,2-dihydropyridine?
The InChIKey is YQVOMPWHCMEKEZ-ZZXKWVIFSA-N. The full InChI is InChI=1S/C15H17N/c1-3-6-13-7-4-5-8-14(13)15-11-12(2)9-10-16-15/h3-9,11,16H,10H2,1-2H3/b6-3+.
What are the key properties of 4-methyl-6-[2-[(E)-prop-1-enyl]phenyl]-1,2-dihydropyridine?
4-methyl-6-[2-[(E)-prop-1-enyl]phenyl]-1,2-dihydropyridine has a molecular weight of 211.31 g/mol, XLogP of 3.61, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-6-[2-[(E)-prop-1-enyl]phenyl]-1,2-dihydropyridine is sourced from PubChem (CID 129276692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).