C17H24F3N3 — CID 129276977
1-[(3Z,5Z)-2-methyl-3-(prop-2-enylideneamino)hepta-1,3,5-trien-4-yl]-5-(trifluoromethyl)piperidin-3-amine (PubChem CID 129276977) has the molecular formula C17H24F3N3 and a molecular weight of 327.39 g/mol. Its IUPAC name is 1-[(3Z,5Z)-2-methyl-3-(prop-2-enylideneamino)hepta-1,3,5-trien-4-yl]-5-(trifluoromethyl)piperidin-3-amine.
| Compound Name | 1-[(3Z,5Z)-2-methyl-3-(prop-2-enylideneamino)hepta-1,3,5-trien-4-yl]-5-(trifluoromethyl)piperidin-3-amine |
|---|---|
| PubChem CID | 129276977 |
| Molecular Formula | C17H24F3N3 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 1-[(3Z,5Z)-2-methyl-3-(prop-2-enylideneamino)hepta-1,3,5-trien-4-yl]-5-(trifluoromethyl)piperidin-3-amine |
| SMILES | C=C/C=N/C(C(=C)C)=C(/C=C\C)N1CC(N)CC(C(F)(F)F)C1 |
| InChI | InChI=1S/C17H24F3N3/c1-5-7-15(16(12(3)4)22-8-6-2)23-10-13(17(18,19)20)9-14(21)11-23/h5-8,13-14H,2-3,9-11,21H2,1,4H3/b7-5+,16-15-,22-8+ |
| InChIKey | JNSHFNXHCZOUBI-GFRMBTAMSA-N |
| XLogP | 3.82 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|