C16H23N3O3 — CID 129277641
2-[4-(2-methoxyethoxy)piperidin-1-yl]-3-methyl-6,7-dihydropyrrolo[3,4-b]pyridin-5-one (PubChem CID 129277641) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is 2-[4-(2-methoxyethoxy)piperidin-1-yl]-3-methyl-6,7-dihydropyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 2-[4-(2-methoxyethoxy)piperidin-1-yl]-3-methyl-6,7-dihydropyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 129277641 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 2-[4-(2-methoxyethoxy)piperidin-1-yl]-3-methyl-6,7-dihydropyrrolo[3,4-b]pyridin-5-one |
| SMILES | COCCOC1CCN(c2nc3c(cc2C)C(=O)NC3)CC1 |
| InChI | InChI=1S/C16H23N3O3/c1-11-9-13-14(10-17-16(13)20)18-15(11)19-5-3-12(4-6-19)22-8-7-21-2/h9,12H,3-8,10H2,1-2H3,(H,17,20) |
| InChIKey | HLOQGXFVOPUHQB-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|