About 6-piperidin-4-yloxy-2,3-dihydrofuro[3,2-b]pyridine
6-piperidin-4-yloxy-2,3-dihydrofuro[3,2-b]pyridine (PubChem CID 129278100) has the molecular formula C12H16N2O2
and a molecular weight of 220.27 g/mol. Its IUPAC name is 6-piperidin-4-yloxy-2,3-dihydrofuro[3,2-b]pyridine.
Molecular Properties
| Compound Name | 6-piperidin-4-yloxy-2,3-dihydrofuro[3,2-b]pyridine |
| PubChem CID | 129278100 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 6-piperidin-4-yloxy-2,3-dihydrofuro[3,2-b]pyridine |
| SMILES | c1nc2c(cc1OC1CCNCC1)OCC2 |
| InChI | InChI=1S/C12H16N2O2/c1-4-13-5-2-9(1)16-10-7-12-11(14-8-10)3-6-15-12/h7-9,13H,1-6H2 |
| InChIKey | SLLDRUOFVCRFHO-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-piperidin-4-yloxy-2,3-dihydrofuro[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-piperidin-4-yloxy-2,3-dihydrofuro[3,2-b]pyridine?
The IUPAC name of 6-piperidin-4-yloxy-2,3-dihydrofuro[3,2-b]pyridine (CID 129278100) is 6-piperidin-4-yloxy-2,3-dihydrofuro[3,2-b]pyridine.
What is the SMILES notation for 6-piperidin-4-yloxy-2,3-dihydrofuro[3,2-b]pyridine?
The canonical SMILES for 6-piperidin-4-yloxy-2,3-dihydrofuro[3,2-b]pyridine is c1nc2c(cc1OC1CCNCC1)OCC2.
What is the InChIKey of 6-piperidin-4-yloxy-2,3-dihydrofuro[3,2-b]pyridine?
The InChIKey is SLLDRUOFVCRFHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O2/c1-4-13-5-2-9(1)16-10-7-12-11(14-8-10)3-6-15-12/h7-9,13H,1-6H2.
What are the key properties of 6-piperidin-4-yloxy-2,3-dihydrofuro[3,2-b]pyridine?
6-piperidin-4-yloxy-2,3-dihydrofuro[3,2-b]pyridine has a molecular weight of 220.27 g/mol, XLogP of 1.15, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-piperidin-4-yloxy-2,3-dihydrofuro[3,2-b]pyridine is sourced from PubChem (CID 129278100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).