About 2-methylpentyl 2-(2-methoxyphenyl)acetate
2-methylpentyl 2-(2-methoxyphenyl)acetate (PubChem CID 129279384) has the molecular formula C15H22O3
and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-methylpentyl 2-(2-methoxyphenyl)acetate.
Molecular Properties
| Compound Name | 2-methylpentyl 2-(2-methoxyphenyl)acetate |
| PubChem CID | 129279384 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 2-methylpentyl 2-(2-methoxyphenyl)acetate |
| SMILES | CCCC(C)COC(=O)Cc1ccccc1OC |
| InChI | InChI=1S/C15H22O3/c1-4-7-12(2)11-18-15(16)10-13-8-5-6-9-14(13)17-3/h5-6,8-9,12H,4,7,10-11H2,1-3H3 |
| InChIKey | OOOLBJUYZNFDDI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylpentyl 2-(2-methoxyphenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpentyl 2-(2-methoxyphenyl)acetate?
The IUPAC name of 2-methylpentyl 2-(2-methoxyphenyl)acetate (CID 129279384) is 2-methylpentyl 2-(2-methoxyphenyl)acetate.
What is the SMILES notation for 2-methylpentyl 2-(2-methoxyphenyl)acetate?
The canonical SMILES for 2-methylpentyl 2-(2-methoxyphenyl)acetate is CCCC(C)COC(=O)Cc1ccccc1OC.
What is the InChIKey of 2-methylpentyl 2-(2-methoxyphenyl)acetate?
The InChIKey is OOOLBJUYZNFDDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O3/c1-4-7-12(2)11-18-15(16)10-13-8-5-6-9-14(13)17-3/h5-6,8-9,12H,4,7,10-11H2,1-3H3.
What are the key properties of 2-methylpentyl 2-(2-methoxyphenyl)acetate?
2-methylpentyl 2-(2-methoxyphenyl)acetate has a molecular weight of 250.34 g/mol, XLogP of 3.22, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpentyl 2-(2-methoxyphenyl)acetate is sourced from PubChem (CID 129279384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).