About N-[2-[4-[[(1R,2S)-2-phenylcyclopropyl]amino]piperidin-1-yl]propyl]methanesulfonamide
N-[2-[4-[[(1R,2S)-2-phenylcyclopropyl]amino]piperidin-1-yl]propyl]methanesulfonamide (PubChem CID 129279605) has the molecular formula C18H29N3O2S
and a molecular weight of 351.52 g/mol. Its IUPAC name is N-[2-[4-[[(1R,2S)-2-phenylcyclopropyl]amino]piperidin-1-yl]propyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[2-[4-[[(1R,2S)-2-phenylcyclopropyl]amino]piperidin-1-yl]propyl]methanesulfonamide |
| PubChem CID | 129279605 |
| Molecular Formula | C18H29N3O2S |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | N-[2-[4-[[(1R,2S)-2-phenylcyclopropyl]amino]piperidin-1-yl]propyl]methanesulfonamide |
| SMILES | CC(CNS(C)(=O)=O)N1CCC(N[C@@H]2C[C@H]2c2ccccc2)CC1 |
| InChI | InChI=1S/C18H29N3O2S/c1-14(13-19-24(2,22)23)21-10-8-16(9-11-21)20-18-12-17(18)15-6-4-3-5-7-15/h3-7,14,16-20H,8-13H2,1-2H3/t14?,17-,18+/m0/s1 |
| InChIKey | VHLYSAMXJQKDAV-CXRLMVSZSA-N |
| XLogP | 1.53 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-[4-[[(1R,2S)-2-phenylcyclopropyl]amino]piperidin-1-yl]propyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[4-[[(1R,2S)-2-phenylcyclopropyl]amino]piperidin-1-yl]propyl]methanesulfonamide?
The IUPAC name of N-[2-[4-[[(1R,2S)-2-phenylcyclopropyl]amino]piperidin-1-yl]propyl]methanesulfonamide (CID 129279605) is N-[2-[4-[[(1R,2S)-2-phenylcyclopropyl]amino]piperidin-1-yl]propyl]methanesulfonamide.
What is the SMILES notation for N-[2-[4-[[(1R,2S)-2-phenylcyclopropyl]amino]piperidin-1-yl]propyl]methanesulfonamide?
The canonical SMILES for N-[2-[4-[[(1R,2S)-2-phenylcyclopropyl]amino]piperidin-1-yl]propyl]methanesulfonamide is CC(CNS(C)(=O)=O)N1CCC(N[C@@H]2C[C@H]2c2ccccc2)CC1.
What is the InChIKey of N-[2-[4-[[(1R,2S)-2-phenylcyclopropyl]amino]piperidin-1-yl]propyl]methanesulfonamide?
The InChIKey is VHLYSAMXJQKDAV-CXRLMVSZSA-N. The full InChI is InChI=1S/C18H29N3O2S/c1-14(13-19-24(2,22)23)21-10-8-16(9-11-21)20-18-12-17(18)15-6-4-3-5-7-15/h3-7,14,16-20H,8-13H2,1-2H3/t14?,17-,18+/m0/s1.
What are the key properties of N-[2-[4-[[(1R,2S)-2-phenylcyclopropyl]amino]piperidin-1-yl]propyl]methanesulfonamide?
N-[2-[4-[[(1R,2S)-2-phenylcyclopropyl]amino]piperidin-1-yl]propyl]methanesulfonamide has a molecular weight of 351.52 g/mol, XLogP of 1.53, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[4-[[(1R,2S)-2-phenylcyclopropyl]amino]piperidin-1-yl]propyl]methanesulfonamide is sourced from PubChem (CID 129279605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).