C23H40N4 — CID 129280131
N',N'-diethyl-N-[[1-[(Z)-1-(6-imino-3-methylcyclohexa-2,4-dien-1-yl)but-2-enyl]piperidin-4-yl]methyl]ethane-1,2-diamine (PubChem CID 129280131) has the molecular formula C23H40N4 and a molecular weight of 372.60 g/mol. Its IUPAC name is N',N'-diethyl-N-[[1-[(Z)-1-(6-imino-3-methylcyclohexa-2,4-dien-1-yl)but-2-enyl]piperidin-4-yl]methyl]ethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-[[1-[(Z)-1-(6-imino-3-methylcyclohexa-2,4-dien-1-yl)but-2-enyl]piperidin-4-yl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 129280131 |
| Molecular Formula | C23H40N4 |
| Molecular Weight | 372.60 g/mol |
| Exact Mass | 372.33 |
| IUPAC Name | N',N'-diethyl-N-[[1-[(Z)-1-(6-imino-3-methylcyclohexa-2,4-dien-1-yl)but-2-enyl]piperidin-4-yl]methyl]ethane-1,2-diamine |
| SMILES | [H]/N=C1\C=CC(C)=CC1C(/C=C\C)N1CCC(CNCCN(CC)CC)CC1 |
| InChI | InChI=1S/C23H40N4/c1-5-8-23(21-17-19(4)9-10-22(21)24)27-14-11-20(12-15-27)18-25-13-16-26(6-2)7-3/h5,8-10,17,20-21,23-25H,6-7,11-16,18H2,1-4H3/b8-5-,24-22+ |
| InChIKey | VPXDDDIBRZPRSW-IZHFNLHRSA-N |
| XLogP | 3.73 |
| TPSA | 42.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.60 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|