C23H39FN4 — CID 129280133
N',N'-diethyl-N-[[1-[1-(4-fluoro-6-iminocyclohexa-2,4-dien-1-yl)-3-methylbut-2-enyl]piperidin-4-yl]methyl]ethane-1,2-diamine (PubChem CID 129280133) has the molecular formula C23H39FN4 and a molecular weight of 390.59 g/mol. Its IUPAC name is N',N'-diethyl-N-[[1-[1-(4-fluoro-6-iminocyclohexa-2,4-dien-1-yl)-3-methylbut-2-enyl]piperidin-4-yl]methyl]ethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-[[1-[1-(4-fluoro-6-iminocyclohexa-2,4-dien-1-yl)-3-methylbut-2-enyl]piperidin-4-yl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 129280133 |
| Molecular Formula | C23H39FN4 |
| Molecular Weight | 390.59 g/mol |
| Exact Mass | 390.32 |
| IUPAC Name | N',N'-diethyl-N-[[1-[1-(4-fluoro-6-iminocyclohexa-2,4-dien-1-yl)-3-methylbut-2-enyl]piperidin-4-yl]methyl]ethane-1,2-diamine |
| SMILES | [H]/N=C1\C=C(F)C=CC1C(C=C(C)C)N1CCC(CNCCN(CC)CC)CC1 |
| InChI | InChI=1S/C23H39FN4/c1-5-27(6-2)14-11-26-17-19-9-12-28(13-10-19)23(15-18(3)4)21-8-7-20(24)16-22(21)25/h7-8,15-16,19,21,23,25-26H,5-6,9-14,17H2,1-4H3/b25-22+ |
| InChIKey | PEUATAVINDPGGA-YYDJUVGSSA-N |
| XLogP | 4.02 |
| TPSA | 42.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.59 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|