C25H24F3N3O3 — CID 129280372
3-[[(1S)-6-[2-methyl-4-(2,2,2-trifluoroethoxy)phenyl]-1,2,3,4-tetrahydroisoquinolin-1-yl]methylamino]pyridine-4-carboxylic acid (PubChem CID 129280372) has the molecular formula C25H24F3N3O3 and a molecular weight of 471.48 g/mol. Its IUPAC name is 3-[[(1S)-6-[2-methyl-4-(2,2,2-trifluoroethoxy)phenyl]-1,2,3,4-tetrahydroisoquinolin-1-yl]methylamino]pyridine-4-carboxylic acid.
| Compound Name | 3-[[(1S)-6-[2-methyl-4-(2,2,2-trifluoroethoxy)phenyl]-1,2,3,4-tetrahydroisoquinolin-1-yl]methylamino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 129280372 |
| Molecular Formula | C25H24F3N3O3 |
| Molecular Weight | 471.48 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 3-[[(1S)-6-[2-methyl-4-(2,2,2-trifluoroethoxy)phenyl]-1,2,3,4-tetrahydroisoquinolin-1-yl]methylamino]pyridine-4-carboxylic acid |
| SMILES | Cc1cc(OCC(F)(F)F)ccc1-c1ccc2c(c1)CCN[C@@H]2CNc1cnccc1C(=O)O |
| InChI | InChI=1S/C25H24F3N3O3/c1-15-10-18(34-14-25(26,27)28)3-5-19(15)16-2-4-20-17(11-16)6-9-30-23(20)13-31-22-12-29-8-7-21(22)24(32)33/h2-5,7-8,10-12,23,30-31H,6,9,13-14H2,1H3,(H,32,33)/t23-/m1/s1 |
| InChIKey | JBILETKNMYCYMF-HSZRJFAPSA-N |
| XLogP | 5.00 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.48 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |