C24H16N2O4S2 — CID 129280510
3,8-bis(2,3-dihydrothieno[2,3-b][1,4]dioxin-6-yl)-1,10-phenanthroline (PubChem CID 129280510) has the molecular formula C24H16N2O4S2 and a molecular weight of 460.54 g/mol. Its IUPAC name is 3,8-bis(2,3-dihydrothieno[2,3-b][1,4]dioxin-6-yl)-1,10-phenanthroline.
| Compound Name | 3,8-bis(2,3-dihydrothieno[2,3-b][1,4]dioxin-6-yl)-1,10-phenanthroline |
|---|---|
| PubChem CID | 129280510 |
| Molecular Formula | C24H16N2O4S2 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | 3,8-bis(2,3-dihydrothieno[2,3-b][1,4]dioxin-6-yl)-1,10-phenanthroline |
| SMILES | c1nc2c(ccc3cc(-c4cc5c(s4)OCCO5)cnc32)cc1-c1cc2c(s1)OCCO2 |
| InChI | InChI=1S/C24H16N2O4S2/c1-2-14-8-16(20-10-18-24(32-20)30-6-4-28-18)12-26-22(14)21-13(1)7-15(11-25-21)19-9-17-23(31-19)29-5-3-27-17/h1-2,7-12H,3-6H2 |
| InChIKey | YIMHBDJLQMVATJ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|