C27H38N4O — CID 129280571
1-[2-[4-(4-methylpiperazin-1-yl)phenoxy]ethyl]-N-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-amine (PubChem CID 129280571) has the molecular formula C27H38N4O and a molecular weight of 434.63 g/mol. Its IUPAC name is 1-[2-[4-(4-methylpiperazin-1-yl)phenoxy]ethyl]-N-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-amine.
| Compound Name | 1-[2-[4-(4-methylpiperazin-1-yl)phenoxy]ethyl]-N-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-amine |
|---|---|
| PubChem CID | 129280571 |
| Molecular Formula | C27H38N4O |
| Molecular Weight | 434.63 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | 1-[2-[4-(4-methylpiperazin-1-yl)phenoxy]ethyl]-N-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-amine |
| SMILES | CN1CCN(c2ccc(OCCN3CCC(N[C@@H]4C[C@H]4c4ccccc4)CC3)cc2)CC1 |
| InChI | InChI=1S/C27H38N4O/c1-29-15-17-31(18-16-29)24-7-9-25(10-8-24)32-20-19-30-13-11-23(12-14-30)28-27-21-26(27)22-5-3-2-4-6-22/h2-10,23,26-28H,11-21H2,1H3/t26-,27+/m0/s1 |
| InChIKey | LXEFFLNTPKQYSF-RRPNLBNLSA-N |
| XLogP | 3.43 |
| TPSA | 30.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.63 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|