C27H33F3O4 — CID 129281056
2-[2-(2,4-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)ethyl]-3,6-dimethyl-5-(9,9,9-trifluorononyl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 129281056) has the molecular formula C27H33F3O4 and a molecular weight of 478.55 g/mol. Its IUPAC name is 2-[2-(2,4-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)ethyl]-3,6-dimethyl-5-(9,9,9-trifluorononyl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[2-(2,4-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)ethyl]-3,6-dimethyl-5-(9,9,9-trifluorononyl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 129281056 |
| Molecular Formula | C27H33F3O4 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | 2-[2-(2,4-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)ethyl]-3,6-dimethyl-5-(9,9,9-trifluorononyl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=CC(=O)C(CCC2=C(C)C(=O)C(CCCCCCCCC(F)(F)F)=C(C)C2=O)=C(C)C1=O |
| InChI | InChI=1S/C27H33F3O4/c1-16-15-23(31)20(17(2)24(16)32)12-13-22-19(4)25(33)21(18(3)26(22)34)11-9-7-5-6-8-10-14-27(28,29)30/h15H,5-14H2,1-4H3 |
| InChIKey | PDKGEWISFZAMOX-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|