C17H30O2 — CID 129281720
[(2E,4Z)-2-ethylhexa-2,4-dienyl] 2-ethyl-4,4-dimethylpentanoate (PubChem CID 129281720) has the molecular formula C17H30O2 and a molecular weight of 266.42 g/mol. Its IUPAC name is [(2E,4Z)-2-ethylhexa-2,4-dienyl] 2-ethyl-4,4-dimethylpentanoate.
| Compound Name | [(2E,4Z)-2-ethylhexa-2,4-dienyl] 2-ethyl-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 129281720 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | [(2E,4Z)-2-ethylhexa-2,4-dienyl] 2-ethyl-4,4-dimethylpentanoate |
| SMILES | C/C=C\C=C(/CC)COC(=O)C(CC)CC(C)(C)C |
| InChI | InChI=1S/C17H30O2/c1-7-10-11-14(8-2)13-19-16(18)15(9-3)12-17(4,5)6/h7,10-11,15H,8-9,12-13H2,1-6H3/b10-7-,14-11+ |
| InChIKey | FRPZUIFWVOQISV-BXHQFMRESA-N |
| XLogP | 4.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|