C33H42ClN7O4S — CID 129281955
N-[5-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-2-(4-cyclohexylpiperazin-1-yl)-4-methoxyphenyl]prop-2-enamide (PubChem CID 129281955) has the molecular formula C33H42ClN7O4S and a molecular weight of 668.26 g/mol. Its IUPAC name is N-[5-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-2-(4-cyclohexylpiperazin-1-yl)-4-methoxyphenyl]prop-2-enamide.
| Compound Name | N-[5-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-2-(4-cyclohexylpiperazin-1-yl)-4-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 129281955 |
| Molecular Formula | C33H42ClN7O4S |
| Molecular Weight | 668.26 g/mol |
| Exact Mass | 667.27 |
| IUPAC Name | N-[5-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-2-(4-cyclohexylpiperazin-1-yl)-4-methoxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2ncc(Cl)c(Nc3ccccc3S(=O)(=O)C(C)C)n2)c(OC)cc1N1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C33H42ClN7O4S/c1-5-31(42)36-26-19-27(29(45-4)20-28(26)41-17-15-40(16-18-41)23-11-7-6-8-12-23)38-33-35-21-24(34)32(39-33)37-25-13-9-10-14-30(25)46(43,44)22(2)3/h5,9-10,13-14,19-23H,1,6-8,11-12,15-18H2,2-4H3,(H,36,42)(H2,35,37,38,39) |
| InChIKey | QMJDDWPSSMHPSO-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 128.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.26 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|