About N-methyl-N-[4-[3-[3-(4-methylphenyl)phenyl]phenyl]cyclohexa-2,4-dien-1-yl]aniline
N-methyl-N-[4-[3-[3-(4-methylphenyl)phenyl]phenyl]cyclohexa-2,4-dien-1-yl]aniline (PubChem CID 129281968) has the molecular formula C32H29N
and a molecular weight of 427.59 g/mol. Its IUPAC name is N-methyl-N-[4-[3-[3-(4-methylphenyl)phenyl]phenyl]cyclohexa-2,4-dien-1-yl]aniline.
Molecular Properties
| Compound Name | N-methyl-N-[4-[3-[3-(4-methylphenyl)phenyl]phenyl]cyclohexa-2,4-dien-1-yl]aniline |
| PubChem CID | 129281968 |
| Molecular Formula | C32H29N |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | N-methyl-N-[4-[3-[3-(4-methylphenyl)phenyl]phenyl]cyclohexa-2,4-dien-1-yl]aniline |
| SMILES | Cc1ccc(-c2cccc(-c3cccc(C4=CCC(N(C)c5ccccc5)C=C4)c3)c2)cc1 |
| InChI | InChI=1S/C32H29N/c1-24-14-16-25(17-15-24)27-8-6-10-29(22-27)30-11-7-9-28(23-30)26-18-20-32(21-19-26)33(2)31-12-4-3-5-13-31/h3-20,22-23,32H,21H2,1-2H3 |
| InChIKey | ADDJZAKHIQJLFB-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-methyl-N-[4-[3-[3-(4-methylphenyl)phenyl]phenyl]cyclohexa-2,4-dien-1-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[4-[3-[3-(4-methylphenyl)phenyl]phenyl]cyclohexa-2,4-dien-1-yl]aniline?
The IUPAC name of N-methyl-N-[4-[3-[3-(4-methylphenyl)phenyl]phenyl]cyclohexa-2,4-dien-1-yl]aniline (CID 129281968) is N-methyl-N-[4-[3-[3-(4-methylphenyl)phenyl]phenyl]cyclohexa-2,4-dien-1-yl]aniline.
What is the SMILES notation for N-methyl-N-[4-[3-[3-(4-methylphenyl)phenyl]phenyl]cyclohexa-2,4-dien-1-yl]aniline?
The canonical SMILES for N-methyl-N-[4-[3-[3-(4-methylphenyl)phenyl]phenyl]cyclohexa-2,4-dien-1-yl]aniline is Cc1ccc(-c2cccc(-c3cccc(C4=CCC(N(C)c5ccccc5)C=C4)c3)c2)cc1.
What is the InChIKey of N-methyl-N-[4-[3-[3-(4-methylphenyl)phenyl]phenyl]cyclohexa-2,4-dien-1-yl]aniline?
The InChIKey is ADDJZAKHIQJLFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H29N/c1-24-14-16-25(17-15-24)27-8-6-10-29(22-27)30-11-7-9-28(23-30)26-18-20-32(21-19-26)33(2)31-12-4-3-5-13-31/h3-20,22-23,32H,21H2,1-2H3.
What are the key properties of N-methyl-N-[4-[3-[3-(4-methylphenyl)phenyl]phenyl]cyclohexa-2,4-dien-1-yl]aniline?
N-methyl-N-[4-[3-[3-(4-methylphenyl)phenyl]phenyl]cyclohexa-2,4-dien-1-yl]aniline has a molecular weight of 427.59 g/mol, XLogP of 8.18, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[4-[3-[3-(4-methylphenyl)phenyl]phenyl]cyclohexa-2,4-dien-1-yl]aniline is sourced from PubChem (CID 129281968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).