About N-heptan-3-ylcyclohexa-1,3-dien-1-amine
N-heptan-3-ylcyclohexa-1,3-dien-1-amine (PubChem CID 129282137) has the molecular formula C13H23N
and a molecular weight of 193.33 g/mol. Its IUPAC name is N-heptan-3-ylcyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | N-heptan-3-ylcyclohexa-1,3-dien-1-amine |
| PubChem CID | 129282137 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | N-heptan-3-ylcyclohexa-1,3-dien-1-amine |
| SMILES | CCCCC(CC)NC1=CC=CCC1 |
| InChI | InChI=1S/C13H23N/c1-3-5-9-12(4-2)14-13-10-7-6-8-11-13/h6-7,10,12,14H,3-5,8-9,11H2,1-2H3 |
| InChIKey | POSNUAOROODTEJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-heptan-3-ylcyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-heptan-3-ylcyclohexa-1,3-dien-1-amine?
The IUPAC name of N-heptan-3-ylcyclohexa-1,3-dien-1-amine (CID 129282137) is N-heptan-3-ylcyclohexa-1,3-dien-1-amine.
What is the SMILES notation for N-heptan-3-ylcyclohexa-1,3-dien-1-amine?
The canonical SMILES for N-heptan-3-ylcyclohexa-1,3-dien-1-amine is CCCCC(CC)NC1=CC=CCC1.
What is the InChIKey of N-heptan-3-ylcyclohexa-1,3-dien-1-amine?
The InChIKey is POSNUAOROODTEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N/c1-3-5-9-12(4-2)14-13-10-7-6-8-11-13/h6-7,10,12,14H,3-5,8-9,11H2,1-2H3.
What are the key properties of N-heptan-3-ylcyclohexa-1,3-dien-1-amine?
N-heptan-3-ylcyclohexa-1,3-dien-1-amine has a molecular weight of 193.33 g/mol, XLogP of 3.78, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-heptan-3-ylcyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 129282137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).