C24H44O2S — CID 129282162
S-[4-[(9Z,12Z)-octadeca-9,12-dienoxy]butyl] ethanethioate (PubChem CID 129282162) has the molecular formula C24H44O2S and a molecular weight of 396.68 g/mol. Its IUPAC name is S-[4-[(9Z,12Z)-octadeca-9,12-dienoxy]butyl] ethanethioate.
| Compound Name | S-[4-[(9Z,12Z)-octadeca-9,12-dienoxy]butyl] ethanethioate |
|---|---|
| PubChem CID | 129282162 |
| Molecular Formula | C24H44O2S |
| Molecular Weight | 396.68 g/mol |
| Exact Mass | 396.31 |
| IUPAC Name | S-[4-[(9Z,12Z)-octadeca-9,12-dienoxy]butyl] ethanethioate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOCCCCSC(C)=O |
| InChI | InChI=1S/C24H44O2S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-26-22-19-20-23-27-24(2)25/h7-8,10-11H,3-6,9,12-23H2,1-2H3/b8-7-,11-10- |
| InChIKey | XWOHXZNTRISJIU-NQLNTKRDSA-N |
| XLogP | 7.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.68 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|