C12H12N2O2 — CID 129283133
(1S)-1-[(5R)-5H-imidazo[5,1-a]isoindol-5-yl]ethane-1,2-diol (PubChem CID 129283133) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is (1S)-1-[(5R)-5H-imidazo[5,1-a]isoindol-5-yl]ethane-1,2-diol.
| Compound Name | (1S)-1-[(5R)-5H-imidazo[5,1-a]isoindol-5-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 129283133 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | (1S)-1-[(5R)-5H-imidazo[5,1-a]isoindol-5-yl]ethane-1,2-diol |
| SMILES | OC[C@@H](O)[C@H]1c2ccccc2-c2cncn21 |
| InChI | InChI=1S/C12H12N2O2/c15-6-11(16)12-9-4-2-1-3-8(9)10-5-13-7-14(10)12/h1-5,7,11-12,15-16H,6H2/t11-,12-/m1/s1 |
| InChIKey | IMCUGBPNZOTWMM-VXGBXAGGSA-N |
| XLogP | 0.81 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |