C20H33NO2 — CID 129283574
tert-butyl 2-[(1S,5R,6R)-6-(aminomethyl)-3-(cyclopentylmethyl)-6-bicyclo[3.2.0]hept-3-enyl]acetate (PubChem CID 129283574) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is tert-butyl 2-[(1S,5R,6R)-6-(aminomethyl)-3-(cyclopentylmethyl)-6-bicyclo[3.2.0]hept-3-enyl]acetate.
| Compound Name | tert-butyl 2-[(1S,5R,6R)-6-(aminomethyl)-3-(cyclopentylmethyl)-6-bicyclo[3.2.0]hept-3-enyl]acetate |
|---|---|
| PubChem CID | 129283574 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | tert-butyl 2-[(1S,5R,6R)-6-(aminomethyl)-3-(cyclopentylmethyl)-6-bicyclo[3.2.0]hept-3-enyl]acetate |
| SMILES | CC(C)(C)OC(=O)C[C@]1(CN)C[C@@H]2CC(CC3CCCC3)=C[C@@H]21 |
| InChI | InChI=1S/C20H33NO2/c1-19(2,3)23-18(22)12-20(13-21)11-16-9-15(10-17(16)20)8-14-6-4-5-7-14/h10,14,16-17H,4-9,11-13,21H2,1-3H3/t16-,17-,20-/m0/s1 |
| InChIKey | RGYHBSOZTZLILD-ZWOKBUDYSA-N |
| XLogP | 4.21 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|