C19H27F2NO4 — CID 129283825
tert-butyl 2-[(1R,5S,6S)-3-[(3,3-difluorocyclobutyl)methyl]-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]acetate (PubChem CID 129283825) has the molecular formula C19H27F2NO4 and a molecular weight of 371.42 g/mol. Its IUPAC name is tert-butyl 2-[(1R,5S,6S)-3-[(3,3-difluorocyclobutyl)methyl]-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]acetate.
| Compound Name | tert-butyl 2-[(1R,5S,6S)-3-[(3,3-difluorocyclobutyl)methyl]-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]acetate |
|---|---|
| PubChem CID | 129283825 |
| Molecular Formula | C19H27F2NO4 |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | tert-butyl 2-[(1R,5S,6S)-3-[(3,3-difluorocyclobutyl)methyl]-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]acetate |
| SMILES | CC(C)(C)OC(=O)C[C@@]1(C[N+](=O)[O-])C[C@H]2CC(CC3CC(F)(F)C3)=C[C@H]21 |
| InChI | InChI=1S/C19H27F2NO4/c1-17(2,3)26-16(23)10-18(11-22(24)25)9-14-5-12(6-15(14)18)4-13-7-19(20,21)8-13/h6,13-15H,4-5,7-11H2,1-3H3/t14-,15-,18-/m1/s1 |
| InChIKey | RTEJHBWXNMVWBX-IIDMSEBBSA-N |
| XLogP | 4.38 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|