C20H29NO — CID 129283911
3,3,5-trimethyl-5-[[(4-prop-2-enylphenyl)methylideneamino]methyl]cyclohexan-1-ol (PubChem CID 129283911) has the molecular formula C20H29NO and a molecular weight of 299.46 g/mol. Its IUPAC name is 3,3,5-trimethyl-5-[[(4-prop-2-enylphenyl)methylideneamino]methyl]cyclohexan-1-ol.
| Compound Name | 3,3,5-trimethyl-5-[[(4-prop-2-enylphenyl)methylideneamino]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 129283911 |
| Molecular Formula | C20H29NO |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | 3,3,5-trimethyl-5-[[(4-prop-2-enylphenyl)methylideneamino]methyl]cyclohexan-1-ol |
| SMILES | C=CCc1ccc(/C=N/CC2(C)CC(O)CC(C)(C)C2)cc1 |
| InChI | InChI=1S/C20H29NO/c1-5-6-16-7-9-17(10-8-16)13-21-15-20(4)12-18(22)11-19(2,3)14-20/h5,7-10,13,18,22H,1,6,11-12,14-15H2,2-4H3/b21-13+ |
| InChIKey | JEQKETKVLDSLAY-FYJGNVAPSA-N |
| XLogP | 4.41 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|