About (7-fluoro-3-methyl-2,4-dihydrochromen-3-yl)methyl methanesulfonate
(7-fluoro-3-methyl-2,4-dihydrochromen-3-yl)methyl methanesulfonate (PubChem CID 129284139) has the molecular formula C12H15FO4S
and a molecular weight of 274.31 g/mol. Its IUPAC name is (7-fluoro-3-methyl-2,4-dihydrochromen-3-yl)methyl methanesulfonate.
Molecular Properties
| Compound Name | (7-fluoro-3-methyl-2,4-dihydrochromen-3-yl)methyl methanesulfonate |
| PubChem CID | 129284139 |
| Molecular Formula | C12H15FO4S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | (7-fluoro-3-methyl-2,4-dihydrochromen-3-yl)methyl methanesulfonate |
| SMILES | CC1(COS(C)(=O)=O)COc2cc(F)ccc2C1 |
| InChI | InChI=1S/C12H15FO4S/c1-12(8-17-18(2,14)15)6-9-3-4-10(13)5-11(9)16-7-12/h3-5H,6-8H2,1-2H3 |
| InChIKey | PBEFBJTVZNIWLP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (7-fluoro-3-methyl-2,4-dihydrochromen-3-yl)methyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-fluoro-3-methyl-2,4-dihydrochromen-3-yl)methyl methanesulfonate?
The IUPAC name of (7-fluoro-3-methyl-2,4-dihydrochromen-3-yl)methyl methanesulfonate (CID 129284139) is (7-fluoro-3-methyl-2,4-dihydrochromen-3-yl)methyl methanesulfonate.
What is the SMILES notation for (7-fluoro-3-methyl-2,4-dihydrochromen-3-yl)methyl methanesulfonate?
The canonical SMILES for (7-fluoro-3-methyl-2,4-dihydrochromen-3-yl)methyl methanesulfonate is CC1(COS(C)(=O)=O)COc2cc(F)ccc2C1.
What is the InChIKey of (7-fluoro-3-methyl-2,4-dihydrochromen-3-yl)methyl methanesulfonate?
The InChIKey is PBEFBJTVZNIWLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15FO4S/c1-12(8-17-18(2,14)15)6-9-3-4-10(13)5-11(9)16-7-12/h3-5H,6-8H2,1-2H3.
What are the key properties of (7-fluoro-3-methyl-2,4-dihydrochromen-3-yl)methyl methanesulfonate?
(7-fluoro-3-methyl-2,4-dihydrochromen-3-yl)methyl methanesulfonate has a molecular weight of 274.31 g/mol, XLogP of 1.74, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7-fluoro-3-methyl-2,4-dihydrochromen-3-yl)methyl methanesulfonate is sourced from PubChem (CID 129284139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).