About 2-[(3R)-3-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxy]pyrrolidin-1-yl]acetamide
2-[(3R)-3-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxy]pyrrolidin-1-yl]acetamide (PubChem CID 129284292) has the molecular formula C16H21N3O5
and a molecular weight of 335.36 g/mol. Its IUPAC name is 2-[(3R)-3-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxy]pyrrolidin-1-yl]acetamide.
Molecular Properties
| Compound Name | 2-[(3R)-3-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxy]pyrrolidin-1-yl]acetamide |
| PubChem CID | 129284292 |
| Molecular Formula | C16H21N3O5 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 2-[(3R)-3-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxy]pyrrolidin-1-yl]acetamide |
| SMILES | CC1(C)Cc2cc([N+](=O)[O-])c(O[C@@H]3CCN(CC(N)=O)C3)cc2O1 |
| InChI | InChI=1S/C16H21N3O5/c1-16(2)7-10-5-12(19(21)22)14(6-13(10)24-16)23-11-3-4-18(8-11)9-15(17)20/h5-6,11H,3-4,7-9H2,1-2H3,(H2,17,20)/t11-/m1/s1 |
| InChIKey | OYIBISYZGRBCET-LLVKDONJSA-N |
| XLogP | 1.25 |
| TPSA | 107.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3R)-3-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxy]pyrrolidin-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3R)-3-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxy]pyrrolidin-1-yl]acetamide?
The IUPAC name of 2-[(3R)-3-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxy]pyrrolidin-1-yl]acetamide (CID 129284292) is 2-[(3R)-3-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxy]pyrrolidin-1-yl]acetamide.
What is the SMILES notation for 2-[(3R)-3-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxy]pyrrolidin-1-yl]acetamide?
The canonical SMILES for 2-[(3R)-3-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxy]pyrrolidin-1-yl]acetamide is CC1(C)Cc2cc([N+](=O)[O-])c(O[C@@H]3CCN(CC(N)=O)C3)cc2O1.
What is the InChIKey of 2-[(3R)-3-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxy]pyrrolidin-1-yl]acetamide?
The InChIKey is OYIBISYZGRBCET-LLVKDONJSA-N. The full InChI is InChI=1S/C16H21N3O5/c1-16(2)7-10-5-12(19(21)22)14(6-13(10)24-16)23-11-3-4-18(8-11)9-15(17)20/h5-6,11H,3-4,7-9H2,1-2H3,(H2,17,20)/t11-/m1/s1.
What are the key properties of 2-[(3R)-3-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxy]pyrrolidin-1-yl]acetamide?
2-[(3R)-3-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxy]pyrrolidin-1-yl]acetamide has a molecular weight of 335.36 g/mol, XLogP of 1.25, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3R)-3-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxy]pyrrolidin-1-yl]acetamide is sourced from PubChem (CID 129284292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).