C12H12F3NO4 — CID 129284485
2,2-dimethyl-5-nitro-6-(2,2,2-trifluoroethoxy)-3H-1-benzofuran (PubChem CID 129284485) has the molecular formula C12H12F3NO4 and a molecular weight of 291.23 g/mol. Its IUPAC name is 2,2-dimethyl-5-nitro-6-(2,2,2-trifluoroethoxy)-3H-1-benzofuran.
| Compound Name | 2,2-dimethyl-5-nitro-6-(2,2,2-trifluoroethoxy)-3H-1-benzofuran |
|---|---|
| PubChem CID | 129284485 |
| Molecular Formula | C12H12F3NO4 |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 2,2-dimethyl-5-nitro-6-(2,2,2-trifluoroethoxy)-3H-1-benzofuran |
| SMILES | CC1(C)Cc2cc([N+](=O)[O-])c(OCC(F)(F)F)cc2O1 |
| InChI | InChI=1S/C12H12F3NO4/c1-11(2)5-7-3-8(16(17)18)10(4-9(7)20-11)19-6-12(13,14)15/h3-4H,5-6H2,1-2H3 |
| InChIKey | WRNPFWAEBBITPZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|