C32H35F3N6O3 — CID 129284503
N-[2,2-dimethyl-6-[4-[2,2,2-trifluoro-1-[(4-methoxyphenyl)methylamino]ethyl]piperidin-1-yl]-3H-1-benzofuran-5-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 129284503) has the molecular formula C32H35F3N6O3 and a molecular weight of 608.67 g/mol. Its IUPAC name is N-[2,2-dimethyl-6-[4-[2,2,2-trifluoro-1-[(4-methoxyphenyl)methylamino]ethyl]piperidin-1-yl]-3H-1-benzofuran-5-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | N-[2,2-dimethyl-6-[4-[2,2,2-trifluoro-1-[(4-methoxyphenyl)methylamino]ethyl]piperidin-1-yl]-3H-1-benzofuran-5-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 129284503 |
| Molecular Formula | C32H35F3N6O3 |
| Molecular Weight | 608.67 g/mol |
| Exact Mass | 608.27 |
| IUPAC Name | N-[2,2-dimethyl-6-[4-[2,2,2-trifluoro-1-[(4-methoxyphenyl)methylamino]ethyl]piperidin-1-yl]-3H-1-benzofuran-5-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | COc1ccc(CNC(C2CCN(c3cc4c(cc3NC(=O)c3cnn5cccnc35)CC(C)(C)O4)CC2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C32H35F3N6O3/c1-31(2)17-22-15-25(39-30(42)24-19-38-41-12-4-11-36-29(24)41)26(16-27(22)44-31)40-13-9-21(10-14-40)28(32(33,34)35)37-18-20-5-7-23(43-3)8-6-20/h4-8,11-12,15-16,19,21,28,37H,9-10,13-14,17-18H2,1-3H3,(H,39,42) |
| InChIKey | GLAXRINRQALJDF-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.67 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |