About (3R)-3-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxy]pyrrolidine-1-carboxylic acid
(3R)-3-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxy]pyrrolidine-1-carboxylic acid (PubChem CID 129284640) has the molecular formula C15H18N2O6
and a molecular weight of 322.32 g/mol. Its IUPAC name is (3R)-3-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxy]pyrrolidine-1-carboxylic acid.
Molecular Properties
| Compound Name | (3R)-3-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxy]pyrrolidine-1-carboxylic acid |
| PubChem CID | 129284640 |
| Molecular Formula | C15H18N2O6 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | (3R)-3-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxy]pyrrolidine-1-carboxylic acid |
| SMILES | CC1(C)Cc2cc([N+](=O)[O-])c(O[C@@H]3CCN(C(=O)O)C3)cc2O1 |
| InChI | InChI=1S/C15H18N2O6/c1-15(2)7-9-5-11(17(20)21)13(6-12(9)23-15)22-10-3-4-16(8-10)14(18)19/h5-6,10H,3-4,7-8H2,1-2H3,(H,18,19)/t10-/m1/s1 |
| InChIKey | QCXKBTPXECAGLH-SNVBAGLBSA-N |
| XLogP | 2.44 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxy]pyrrolidine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxy]pyrrolidine-1-carboxylic acid?
The IUPAC name of (3R)-3-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxy]pyrrolidine-1-carboxylic acid (CID 129284640) is (3R)-3-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxy]pyrrolidine-1-carboxylic acid.
What is the SMILES notation for (3R)-3-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxy]pyrrolidine-1-carboxylic acid?
The canonical SMILES for (3R)-3-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxy]pyrrolidine-1-carboxylic acid is CC1(C)Cc2cc([N+](=O)[O-])c(O[C@@H]3CCN(C(=O)O)C3)cc2O1.
What is the InChIKey of (3R)-3-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxy]pyrrolidine-1-carboxylic acid?
The InChIKey is QCXKBTPXECAGLH-SNVBAGLBSA-N. The full InChI is InChI=1S/C15H18N2O6/c1-15(2)7-9-5-11(17(20)21)13(6-12(9)23-15)22-10-3-4-16(8-10)14(18)19/h5-6,10H,3-4,7-8H2,1-2H3,(H,18,19)/t10-/m1/s1.
What are the key properties of (3R)-3-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxy]pyrrolidine-1-carboxylic acid?
(3R)-3-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxy]pyrrolidine-1-carboxylic acid has a molecular weight of 322.32 g/mol, XLogP of 2.44, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)oxy]pyrrolidine-1-carboxylic acid is sourced from PubChem (CID 129284640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).