C10H12F3N3O4 — CID 129285385
2-oxo-2-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]pentylamino]acetic acid (PubChem CID 129285385) has the molecular formula C10H12F3N3O4 and a molecular weight of 295.22 g/mol. Its IUPAC name is 2-oxo-2-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]pentylamino]acetic acid.
| Compound Name | 2-oxo-2-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]pentylamino]acetic acid |
|---|---|
| PubChem CID | 129285385 |
| Molecular Formula | C10H12F3N3O4 |
| Molecular Weight | 295.22 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 2-oxo-2-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]pentylamino]acetic acid |
| SMILES | CC(CCCNC(=O)C(=O)O)c1noc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H12F3N3O4/c1-5(3-2-4-14-7(17)8(18)19)6-15-9(20-16-6)10(11,12)13/h5H,2-4H2,1H3,(H,14,17)(H,18,19) |
| InChIKey | PEWRPYAQROLHTO-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.22 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|