About 3-iodo-2-methyl-5,6,7,8-tetrahydro-3H-quinolin-4-one
3-iodo-2-methyl-5,6,7,8-tetrahydro-3H-quinolin-4-one (PubChem CID 129285873) has the molecular formula C10H12INO
and a molecular weight of 289.12 g/mol. Its IUPAC name is 3-iodo-2-methyl-5,6,7,8-tetrahydro-3H-quinolin-4-one.
Molecular Properties
| Compound Name | 3-iodo-2-methyl-5,6,7,8-tetrahydro-3H-quinolin-4-one |
| PubChem CID | 129285873 |
| Molecular Formula | C10H12INO |
| Molecular Weight | 289.12 g/mol |
| Exact Mass | 289.00 |
| IUPAC Name | 3-iodo-2-methyl-5,6,7,8-tetrahydro-3H-quinolin-4-one |
| SMILES | CC1=NC2=C(CCCC2)C(=O)C1I |
| InChI | InChI=1S/C10H12INO/c1-6-9(11)10(13)7-4-2-3-5-8(7)12-6/h9H,2-5H2,1H3 |
| InChIKey | JWQBCEQVJOFGBU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.12 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-2-methyl-5,6,7,8-tetrahydro-3H-quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-2-methyl-5,6,7,8-tetrahydro-3H-quinolin-4-one?
The IUPAC name of 3-iodo-2-methyl-5,6,7,8-tetrahydro-3H-quinolin-4-one (CID 129285873) is 3-iodo-2-methyl-5,6,7,8-tetrahydro-3H-quinolin-4-one.
What is the SMILES notation for 3-iodo-2-methyl-5,6,7,8-tetrahydro-3H-quinolin-4-one?
The canonical SMILES for 3-iodo-2-methyl-5,6,7,8-tetrahydro-3H-quinolin-4-one is CC1=NC2=C(CCCC2)C(=O)C1I.
What is the InChIKey of 3-iodo-2-methyl-5,6,7,8-tetrahydro-3H-quinolin-4-one?
The InChIKey is JWQBCEQVJOFGBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12INO/c1-6-9(11)10(13)7-4-2-3-5-8(7)12-6/h9H,2-5H2,1H3.
What are the key properties of 3-iodo-2-methyl-5,6,7,8-tetrahydro-3H-quinolin-4-one?
3-iodo-2-methyl-5,6,7,8-tetrahydro-3H-quinolin-4-one has a molecular weight of 289.12 g/mol, XLogP of 2.66, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-2-methyl-5,6,7,8-tetrahydro-3H-quinolin-4-one is sourced from PubChem (CID 129285873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).