C13H13F4N5O — CID 129285899
4-N-methyl-2-N-phenyl-6-(2,2,3,3-tetrafluoropropoxy)-1,3,5-triazine-2,4-diamine (PubChem CID 129285899) has the molecular formula C13H13F4N5O and a molecular weight of 331.27 g/mol. Its IUPAC name is 4-N-methyl-2-N-phenyl-6-(2,2,3,3-tetrafluoropropoxy)-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-methyl-2-N-phenyl-6-(2,2,3,3-tetrafluoropropoxy)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 129285899 |
| Molecular Formula | C13H13F4N5O |
| Molecular Weight | 331.27 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 4-N-methyl-2-N-phenyl-6-(2,2,3,3-tetrafluoropropoxy)-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1nc(Nc2ccccc2)nc(OCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C13H13F4N5O/c1-18-10-20-11(19-8-5-3-2-4-6-8)22-12(21-10)23-7-13(16,17)9(14)15/h2-6,9H,7H2,1H3,(H2,18,19,20,21,22) |
| InChIKey | UFPNHTFOOMLHLD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|