C17H17F6N5O3 — CID 129285924
3-[[4-(diethylamino)-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,5-triazin-2-yl]amino]benzoic acid (PubChem CID 129285924) has the molecular formula C17H17F6N5O3 and a molecular weight of 453.34 g/mol. Its IUPAC name is 3-[[4-(diethylamino)-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,5-triazin-2-yl]amino]benzoic acid.
| Compound Name | 3-[[4-(diethylamino)-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,5-triazin-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 129285924 |
| Molecular Formula | C17H17F6N5O3 |
| Molecular Weight | 453.34 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | 3-[[4-(diethylamino)-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,5-triazin-2-yl]amino]benzoic acid |
| SMILES | CCN(CC)c1nc(Nc2cccc(C(=O)O)c2)nc(OC(C(F)(F)F)C(F)(F)F)n1 |
| InChI | InChI=1S/C17H17F6N5O3/c1-3-28(4-2)14-25-13(24-10-7-5-6-9(8-10)11(29)30)26-15(27-14)31-12(16(18,19)20)17(21,22)23/h5-8,12H,3-4H2,1-2H3,(H,29,30)(H,24,25,26,27) |
| InChIKey | QNFDPNRDPHDIFG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 100.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.34 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |