C16H18ClF4N5O — CID 129285968
4-N-(3-chlorophenyl)-2-N,2-N-diethyl-6-(2,2,3,3-tetrafluoropropoxy)-1,3,5-triazine-2,4-diamine (PubChem CID 129285968) has the molecular formula C16H18ClF4N5O and a molecular weight of 407.80 g/mol. Its IUPAC name is 4-N-(3-chlorophenyl)-2-N,2-N-diethyl-6-(2,2,3,3-tetrafluoropropoxy)-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-(3-chlorophenyl)-2-N,2-N-diethyl-6-(2,2,3,3-tetrafluoropropoxy)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 129285968 |
| Molecular Formula | C16H18ClF4N5O |
| Molecular Weight | 407.80 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 4-N-(3-chlorophenyl)-2-N,2-N-diethyl-6-(2,2,3,3-tetrafluoropropoxy)-1,3,5-triazine-2,4-diamine |
| SMILES | CCN(CC)c1nc(Nc2cccc(Cl)c2)nc(OCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C16H18ClF4N5O/c1-3-26(4-2)14-23-13(22-11-7-5-6-10(17)8-11)24-15(25-14)27-9-16(20,21)12(18)19/h5-8,12H,3-4,9H2,1-2H3,(H,22,23,24,25) |
| InChIKey | HRXAUVKTIDDIJZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.80 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|