About 4-methyl-6,7-dihydropyrrolo[3,4-b]pyridin-5-one
4-methyl-6,7-dihydropyrrolo[3,4-b]pyridin-5-one (PubChem CID 129285993) has the molecular formula C8H8N2O
and a molecular weight of 148.16 g/mol. Its IUPAC name is 4-methyl-6,7-dihydropyrrolo[3,4-b]pyridin-5-one.
Molecular Properties
| Compound Name | 4-methyl-6,7-dihydropyrrolo[3,4-b]pyridin-5-one |
| PubChem CID | 129285993 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 4-methyl-6,7-dihydropyrrolo[3,4-b]pyridin-5-one |
| SMILES | Cc1ccnc2c1C(=O)NC2 |
| InChI | InChI=1S/C8H8N2O/c1-5-2-3-9-6-4-10-8(11)7(5)6/h2-3H,4H2,1H3,(H,10,11) |
| InChIKey | GADKBBPUIXIQIS-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-6,7-dihydropyrrolo[3,4-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-6,7-dihydropyrrolo[3,4-b]pyridin-5-one?
The IUPAC name of 4-methyl-6,7-dihydropyrrolo[3,4-b]pyridin-5-one (CID 129285993) is 4-methyl-6,7-dihydropyrrolo[3,4-b]pyridin-5-one.
What is the SMILES notation for 4-methyl-6,7-dihydropyrrolo[3,4-b]pyridin-5-one?
The canonical SMILES for 4-methyl-6,7-dihydropyrrolo[3,4-b]pyridin-5-one is Cc1ccnc2c1C(=O)NC2.
What is the InChIKey of 4-methyl-6,7-dihydropyrrolo[3,4-b]pyridin-5-one?
The InChIKey is GADKBBPUIXIQIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O/c1-5-2-3-9-6-4-10-8(11)7(5)6/h2-3H,4H2,1H3,(H,10,11).
What are the key properties of 4-methyl-6,7-dihydropyrrolo[3,4-b]pyridin-5-one?
4-methyl-6,7-dihydropyrrolo[3,4-b]pyridin-5-one has a molecular weight of 148.16 g/mol, XLogP of 0.63, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-6,7-dihydropyrrolo[3,4-b]pyridin-5-one is sourced from PubChem (CID 129285993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).