About 1-(4-chlorothieno[3,2-d]pyrimidin-6-yl)-2,2,2-trifluoroethanone
1-(4-chlorothieno[3,2-d]pyrimidin-6-yl)-2,2,2-trifluoroethanone (PubChem CID 129286021) has the molecular formula C8H2ClF3N2OS
and a molecular weight of 266.63 g/mol. Its IUPAC name is 1-(4-chlorothieno[3,2-d]pyrimidin-6-yl)-2,2,2-trifluoroethanone.
Molecular Properties
| Compound Name | 1-(4-chlorothieno[3,2-d]pyrimidin-6-yl)-2,2,2-trifluoroethanone |
| PubChem CID | 129286021 |
| Molecular Formula | C8H2ClF3N2OS |
| Molecular Weight | 266.63 g/mol |
| Exact Mass | 265.95 |
| IUPAC Name | 1-(4-chlorothieno[3,2-d]pyrimidin-6-yl)-2,2,2-trifluoroethanone |
| SMILES | O=C(c1cc2ncnc(Cl)c2s1)C(F)(F)F |
| InChI | InChI=1S/C8H2ClF3N2OS/c9-7-5-3(13-2-14-7)1-4(16-5)6(15)8(10,11)12/h1-2H |
| InChIKey | KESCFKUXCSBVCV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.63 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-chlorothieno[3,2-d]pyrimidin-6-yl)-2,2,2-trifluoroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorothieno[3,2-d]pyrimidin-6-yl)-2,2,2-trifluoroethanone?
The IUPAC name of 1-(4-chlorothieno[3,2-d]pyrimidin-6-yl)-2,2,2-trifluoroethanone (CID 129286021) is 1-(4-chlorothieno[3,2-d]pyrimidin-6-yl)-2,2,2-trifluoroethanone.
What is the SMILES notation for 1-(4-chlorothieno[3,2-d]pyrimidin-6-yl)-2,2,2-trifluoroethanone?
The canonical SMILES for 1-(4-chlorothieno[3,2-d]pyrimidin-6-yl)-2,2,2-trifluoroethanone is O=C(c1cc2ncnc(Cl)c2s1)C(F)(F)F.
What is the InChIKey of 1-(4-chlorothieno[3,2-d]pyrimidin-6-yl)-2,2,2-trifluoroethanone?
The InChIKey is KESCFKUXCSBVCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H2ClF3N2OS/c9-7-5-3(13-2-14-7)1-4(16-5)6(15)8(10,11)12/h1-2H.
What are the key properties of 1-(4-chlorothieno[3,2-d]pyrimidin-6-yl)-2,2,2-trifluoroethanone?
1-(4-chlorothieno[3,2-d]pyrimidin-6-yl)-2,2,2-trifluoroethanone has a molecular weight of 266.63 g/mol, XLogP of 3.09, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorothieno[3,2-d]pyrimidin-6-yl)-2,2,2-trifluoroethanone is sourced from PubChem (CID 129286021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).