About 5-chloro-4-N,2-dimethyl-4-N-(4-methylsulfanylphenyl)pyrimidine-4,6-diamine
5-chloro-4-N,2-dimethyl-4-N-(4-methylsulfanylphenyl)pyrimidine-4,6-diamine (PubChem CID 129286722) has the molecular formula C13H15ClN4S
and a molecular weight of 294.81 g/mol. Its IUPAC name is 5-chloro-4-N,2-dimethyl-4-N-(4-methylsulfanylphenyl)pyrimidine-4,6-diamine.
Molecular Properties
| Compound Name | 5-chloro-4-N,2-dimethyl-4-N-(4-methylsulfanylphenyl)pyrimidine-4,6-diamine |
| PubChem CID | 129286722 |
| Molecular Formula | C13H15ClN4S |
| Molecular Weight | 294.81 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 5-chloro-4-N,2-dimethyl-4-N-(4-methylsulfanylphenyl)pyrimidine-4,6-diamine |
| SMILES | CSc1ccc(N(C)c2nc(C)nc(N)c2Cl)cc1 |
| InChI | InChI=1S/C13H15ClN4S/c1-8-16-12(15)11(14)13(17-8)18(2)9-4-6-10(19-3)7-5-9/h4-7H,1-3H3,(H2,15,16,17) |
| InChIKey | IQMQLLVRUQQEIK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.81 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-chloro-4-N,2-dimethyl-4-N-(4-methylsulfanylphenyl)pyrimidine-4,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-4-N,2-dimethyl-4-N-(4-methylsulfanylphenyl)pyrimidine-4,6-diamine?
The IUPAC name of 5-chloro-4-N,2-dimethyl-4-N-(4-methylsulfanylphenyl)pyrimidine-4,6-diamine (CID 129286722) is 5-chloro-4-N,2-dimethyl-4-N-(4-methylsulfanylphenyl)pyrimidine-4,6-diamine.
What is the SMILES notation for 5-chloro-4-N,2-dimethyl-4-N-(4-methylsulfanylphenyl)pyrimidine-4,6-diamine?
The canonical SMILES for 5-chloro-4-N,2-dimethyl-4-N-(4-methylsulfanylphenyl)pyrimidine-4,6-diamine is CSc1ccc(N(C)c2nc(C)nc(N)c2Cl)cc1.
What is the InChIKey of 5-chloro-4-N,2-dimethyl-4-N-(4-methylsulfanylphenyl)pyrimidine-4,6-diamine?
The InChIKey is IQMQLLVRUQQEIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15ClN4S/c1-8-16-12(15)11(14)13(17-8)18(2)9-4-6-10(19-3)7-5-9/h4-7H,1-3H3,(H2,15,16,17).
What are the key properties of 5-chloro-4-N,2-dimethyl-4-N-(4-methylsulfanylphenyl)pyrimidine-4,6-diamine?
5-chloro-4-N,2-dimethyl-4-N-(4-methylsulfanylphenyl)pyrimidine-4,6-diamine has a molecular weight of 294.81 g/mol, XLogP of 3.51, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-4-N,2-dimethyl-4-N-(4-methylsulfanylphenyl)pyrimidine-4,6-diamine is sourced from PubChem (CID 129286722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).