C10H10N2O2 — CID 129287800
4-ethyl-1,8-dihydro-1,8-naphthyridine-2,7-dione (PubChem CID 129287800) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 4-ethyl-1,8-dihydro-1,8-naphthyridine-2,7-dione.
| Compound Name | 4-ethyl-1,8-dihydro-1,8-naphthyridine-2,7-dione |
|---|---|
| PubChem CID | 129287800 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 4-ethyl-1,8-dihydro-1,8-naphthyridine-2,7-dione |
| SMILES | CCc1cc(=O)[nH]c2[nH]c(=O)ccc12 |
| InChI | InChI=1S/C10H10N2O2/c1-2-6-5-9(14)12-10-7(6)3-4-8(13)11-10/h3-5H,2H2,1H3,(H2,11,12,13,14) |
| InChIKey | ZJVCIYUKUYOUIM-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |