C34H69N — CID 129288005
(Z)-10-(3,5-dimethylheptyl)-4-ethyl-2,7,12,12,14,14-hexamethylheptadec-5-en-9-amine (PubChem CID 129288005) has the molecular formula C34H69N and a molecular weight of 491.93 g/mol. Its IUPAC name is (Z)-10-(3,5-dimethylheptyl)-4-ethyl-2,7,12,12,14,14-hexamethylheptadec-5-en-9-amine.
| Compound Name | (Z)-10-(3,5-dimethylheptyl)-4-ethyl-2,7,12,12,14,14-hexamethylheptadec-5-en-9-amine |
|---|---|
| PubChem CID | 129288005 |
| Molecular Formula | C34H69N |
| Molecular Weight | 491.93 g/mol |
| Exact Mass | 491.54 |
| IUPAC Name | (Z)-10-(3,5-dimethylheptyl)-4-ethyl-2,7,12,12,14,14-hexamethylheptadec-5-en-9-amine |
| SMILES | CCCC(C)(C)CC(C)(C)CC(CCC(C)CC(C)CC)C(N)CC(C)/C=C\C(CC)CC(C)C |
| InChI | InChI=1S/C34H69N/c1-13-20-33(9,10)25-34(11,12)24-31(19-17-28(7)22-27(6)14-2)32(35)23-29(8)16-18-30(15-3)21-26(4)5/h16,18,26-32H,13-15,17,19-25,35H2,1-12H3/b18-16- |
| InChIKey | FHAGJEVLGAZPPJ-VLGSPTGOSA-N |
| XLogP | 11.07 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.93 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|