C16H13Cl2N3O — CID 12928809
N-[2-(2,4-dichlorophenoxy)ethyl]quinazolin-4-amine (PubChem CID 12928809) has the molecular formula C16H13Cl2N3O and a molecular weight of 334.21 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenoxy)ethyl]quinazolin-4-amine.
| Compound Name | N-[2-(2,4-dichlorophenoxy)ethyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 12928809 |
| Molecular Formula | C16H13Cl2N3O |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | N-[2-(2,4-dichlorophenoxy)ethyl]quinazolin-4-amine |
| SMILES | Clc1ccc(OCCNc2ncnc3ccccc23)c(Cl)c1 |
| InChI | InChI=1S/C16H13Cl2N3O/c17-11-5-6-15(13(18)9-11)22-8-7-19-16-12-3-1-2-4-14(12)20-10-21-16/h1-6,9-10H,7-8H2,(H,19,20,21) |
| InChIKey | PGCXAAOZOBWVHJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|