About (3-benzoyl-1,1-dioxo-2-prop-2-enyl-1lambda6,2-benzothiazin-4-yl) 2-phenoxyacetate
(3-benzoyl-1,1-dioxo-2-prop-2-enyl-1lambda6,2-benzothiazin-4-yl) 2-phenoxyacetate (PubChem CID 1292883) has the molecular formula C26H21NO6S
and a molecular weight of 475.52 g/mol. Its IUPAC name is (3-benzoyl-1,1-dioxo-2-prop-2-enyl-1lambda6,2-benzothiazin-4-yl) 2-phenoxyacetate.
Molecular Properties
| Compound Name | (3-benzoyl-1,1-dioxo-2-prop-2-enyl-1lambda6,2-benzothiazin-4-yl) 2-phenoxyacetate |
| PubChem CID | 1292883 |
| Molecular Formula | C26H21NO6S |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | (3-benzoyl-1,1-dioxo-2-prop-2-enyl-1lambda6,2-benzothiazin-4-yl) 2-phenoxyacetate |
| SMILES | C=CCN1C(C(=O)c2ccccc2)=C(OC(=O)COc2ccccc2)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C26H21NO6S/c1-2-17-27-24(25(29)19-11-5-3-6-12-19)26(21-15-9-10-16-22(21)34(27,30)31)33-23(28)18-32-20-13-7-4-8-14-20/h2-16H,1,17-18H2 |
| InChIKey | FUFWJXZDRQRPPG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3-benzoyl-1,1-dioxo-2-prop-2-enyl-1lambda6,2-benzothiazin-4-yl) 2-phenoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-benzoyl-1,1-dioxo-2-prop-2-enyl-1lambda6,2-benzothiazin-4-yl) 2-phenoxyacetate?
The IUPAC name of (3-benzoyl-1,1-dioxo-2-prop-2-enyl-1lambda6,2-benzothiazin-4-yl) 2-phenoxyacetate (CID 1292883) is (3-benzoyl-1,1-dioxo-2-prop-2-enyl-1lambda6,2-benzothiazin-4-yl) 2-phenoxyacetate.
What is the SMILES notation for (3-benzoyl-1,1-dioxo-2-prop-2-enyl-1lambda6,2-benzothiazin-4-yl) 2-phenoxyacetate?
The canonical SMILES for (3-benzoyl-1,1-dioxo-2-prop-2-enyl-1lambda6,2-benzothiazin-4-yl) 2-phenoxyacetate is C=CCN1C(C(=O)c2ccccc2)=C(OC(=O)COc2ccccc2)c2ccccc2S1(=O)=O.
What is the InChIKey of (3-benzoyl-1,1-dioxo-2-prop-2-enyl-1lambda6,2-benzothiazin-4-yl) 2-phenoxyacetate?
The InChIKey is FUFWJXZDRQRPPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H21NO6S/c1-2-17-27-24(25(29)19-11-5-3-6-12-19)26(21-15-9-10-16-22(21)34(27,30)31)33-23(28)18-32-20-13-7-4-8-14-20/h2-16H,1,17-18H2.
What are the key properties of (3-benzoyl-1,1-dioxo-2-prop-2-enyl-1lambda6,2-benzothiazin-4-yl) 2-phenoxyacetate?
(3-benzoyl-1,1-dioxo-2-prop-2-enyl-1lambda6,2-benzothiazin-4-yl) 2-phenoxyacetate has a molecular weight of 475.52 g/mol, XLogP of 4.05, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-benzoyl-1,1-dioxo-2-prop-2-enyl-1lambda6,2-benzothiazin-4-yl) 2-phenoxyacetate is sourced from PubChem (CID 1292883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).