About 5-fluoro-2,3-dimethyl-4-[(6-methyl-2-pyridinyl)methyl]-1H-indole-7-carbonitrile
5-fluoro-2,3-dimethyl-4-[(6-methyl-2-pyridinyl)methyl]-1H-indole-7-carbonitrile (PubChem CID 129288724) has the molecular formula C18H16FN3
and a molecular weight of 293.34 g/mol. Its IUPAC name is 5-fluoro-2,3-dimethyl-4-[(6-methyl-2-pyridinyl)methyl]-1H-indole-7-carbonitrile.
Molecular Properties
| Compound Name | 5-fluoro-2,3-dimethyl-4-[(6-methyl-2-pyridinyl)methyl]-1H-indole-7-carbonitrile |
| PubChem CID | 129288724 |
| Molecular Formula | C18H16FN3 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 5-fluoro-2,3-dimethyl-4-[(6-methyl-2-pyridinyl)methyl]-1H-indole-7-carbonitrile |
| SMILES | Cc1cccc(Cc2c(F)cc(C#N)c3[nH]c(C)c(C)c23)n1 |
| InChI | InChI=1S/C18H16FN3/c1-10-5-4-6-14(21-10)8-15-16(19)7-13(9-20)18-17(15)11(2)12(3)22-18/h4-7,22H,8H2,1-3H3 |
| InChIKey | URQCIICVYBTGBD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoro-2,3-dimethyl-4-[(6-methyl-2-pyridinyl)methyl]-1H-indole-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2,3-dimethyl-4-[(6-methyl-2-pyridinyl)methyl]-1H-indole-7-carbonitrile?
The IUPAC name of 5-fluoro-2,3-dimethyl-4-[(6-methyl-2-pyridinyl)methyl]-1H-indole-7-carbonitrile (CID 129288724) is 5-fluoro-2,3-dimethyl-4-[(6-methyl-2-pyridinyl)methyl]-1H-indole-7-carbonitrile.
What is the SMILES notation for 5-fluoro-2,3-dimethyl-4-[(6-methyl-2-pyridinyl)methyl]-1H-indole-7-carbonitrile?
The canonical SMILES for 5-fluoro-2,3-dimethyl-4-[(6-methyl-2-pyridinyl)methyl]-1H-indole-7-carbonitrile is Cc1cccc(Cc2c(F)cc(C#N)c3[nH]c(C)c(C)c23)n1.
What is the InChIKey of 5-fluoro-2,3-dimethyl-4-[(6-methyl-2-pyridinyl)methyl]-1H-indole-7-carbonitrile?
The InChIKey is URQCIICVYBTGBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16FN3/c1-10-5-4-6-14(21-10)8-15-16(19)7-13(9-20)18-17(15)11(2)12(3)22-18/h4-7,22H,8H2,1-3H3.
What are the key properties of 5-fluoro-2,3-dimethyl-4-[(6-methyl-2-pyridinyl)methyl]-1H-indole-7-carbonitrile?
5-fluoro-2,3-dimethyl-4-[(6-methyl-2-pyridinyl)methyl]-1H-indole-7-carbonitrile has a molecular weight of 293.34 g/mol, XLogP of 4.09, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2,3-dimethyl-4-[(6-methyl-2-pyridinyl)methyl]-1H-indole-7-carbonitrile is sourced from PubChem (CID 129288724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).