C23H26N2O5S — CID 129289016
(4aS,8aS,9S)-3-butoxy-9-(dimethylamino)-4a-hydroxy-7-phenylsulfanyl-8a,9-dihydro-8H-benzo[f][1,2]benzoxazole-4,5-dione (PubChem CID 129289016) has the molecular formula C23H26N2O5S and a molecular weight of 442.54 g/mol. Its IUPAC name is (4aS,8aS,9S)-3-butoxy-9-(dimethylamino)-4a-hydroxy-7-phenylsulfanyl-8a,9-dihydro-8H-benzo[f][1,2]benzoxazole-4,5-dione.
| Compound Name | (4aS,8aS,9S)-3-butoxy-9-(dimethylamino)-4a-hydroxy-7-phenylsulfanyl-8a,9-dihydro-8H-benzo[f][1,2]benzoxazole-4,5-dione |
|---|---|
| PubChem CID | 129289016 |
| Molecular Formula | C23H26N2O5S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | (4aS,8aS,9S)-3-butoxy-9-(dimethylamino)-4a-hydroxy-7-phenylsulfanyl-8a,9-dihydro-8H-benzo[f][1,2]benzoxazole-4,5-dione |
| SMILES | CCCCOc1noc2c1C(=O)[C@@]1(O)C(=O)C=C(Sc3ccccc3)C[C@H]1[C@@H]2N(C)C |
| InChI | InChI=1S/C23H26N2O5S/c1-4-5-11-29-22-18-20(30-24-22)19(25(2)3)16-12-15(31-14-9-7-6-8-10-14)13-17(26)23(16,28)21(18)27/h6-10,13,16,19,28H,4-5,11-12H2,1-3H3/t16-,19-,23-/m0/s1 |
| InChIKey | CVAFSFMZMHUZSN-NVVBAYIOSA-N |
| XLogP | 3.65 |
| TPSA | 92.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|