C36H25N7O — CID 129289386
10-[3,10-bis(3-methylphenyl)-2,4,5,8,9,11-hexazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),3,5,7,9,13,15-heptaen-14-yl]phenoxazine (PubChem CID 129289386) has the molecular formula C36H25N7O and a molecular weight of 571.64 g/mol. Its IUPAC name is 10-[3,10-bis(3-methylphenyl)-2,4,5,8,9,11-hexazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),3,5,7,9,13,15-heptaen-14-yl]phenoxazine.
| Compound Name | 10-[3,10-bis(3-methylphenyl)-2,4,5,8,9,11-hexazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),3,5,7,9,13,15-heptaen-14-yl]phenoxazine |
|---|---|
| PubChem CID | 129289386 |
| Molecular Formula | C36H25N7O |
| Molecular Weight | 571.64 g/mol |
| Exact Mass | 571.21 |
| IUPAC Name | 10-[3,10-bis(3-methylphenyl)-2,4,5,8,9,11-hexazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),3,5,7,9,13,15-heptaen-14-yl]phenoxazine |
| SMILES | Cc1cccc(-c2nnc3c4nnc(-c5cccc(C)c5)n4c4cc(N5c6ccccc6Oc6ccccc65)ccc4n23)c1 |
| InChI | InChI=1S/C36H25N7O/c1-22-9-7-11-24(19-22)33-37-39-35-36-40-38-34(25-12-8-10-23(2)20-25)43(36)30-21-26(17-18-27(30)42(33)35)41-28-13-3-5-15-31(28)44-32-16-6-4-14-29(32)41/h3-21H,1-2H3 |
| InChIKey | KVYDTXDEUYNWPX-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 72.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.64 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |