About 7-(iodomethyl)-1,3-dimethyl-4,5-dihydropurine-2,6-dione
7-(iodomethyl)-1,3-dimethyl-4,5-dihydropurine-2,6-dione (PubChem CID 129289619) has the molecular formula C8H11IN4O2
and a molecular weight of 322.11 g/mol. Its IUPAC name is 7-(iodomethyl)-1,3-dimethyl-4,5-dihydropurine-2,6-dione.
Molecular Properties
| Compound Name | 7-(iodomethyl)-1,3-dimethyl-4,5-dihydropurine-2,6-dione |
| PubChem CID | 129289619 |
| Molecular Formula | C8H11IN4O2 |
| Molecular Weight | 322.11 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | 7-(iodomethyl)-1,3-dimethyl-4,5-dihydropurine-2,6-dione |
| SMILES | CN1C(=O)C2C(N=CN2CI)N(C)C1=O |
| InChI | InChI=1S/C8H11IN4O2/c1-11-6-5(13(3-9)4-10-6)7(14)12(2)8(11)15/h4-6H,3H2,1-2H3 |
| InChIKey | YZQHWPGKXSGCKB-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.11 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 7-(iodomethyl)-1,3-dimethyl-4,5-dihydropurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(iodomethyl)-1,3-dimethyl-4,5-dihydropurine-2,6-dione?
The IUPAC name of 7-(iodomethyl)-1,3-dimethyl-4,5-dihydropurine-2,6-dione (CID 129289619) is 7-(iodomethyl)-1,3-dimethyl-4,5-dihydropurine-2,6-dione.
What is the SMILES notation for 7-(iodomethyl)-1,3-dimethyl-4,5-dihydropurine-2,6-dione?
The canonical SMILES for 7-(iodomethyl)-1,3-dimethyl-4,5-dihydropurine-2,6-dione is CN1C(=O)C2C(N=CN2CI)N(C)C1=O.
What is the InChIKey of 7-(iodomethyl)-1,3-dimethyl-4,5-dihydropurine-2,6-dione?
The InChIKey is YZQHWPGKXSGCKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11IN4O2/c1-11-6-5(13(3-9)4-10-6)7(14)12(2)8(11)15/h4-6H,3H2,1-2H3.
What are the key properties of 7-(iodomethyl)-1,3-dimethyl-4,5-dihydropurine-2,6-dione?
7-(iodomethyl)-1,3-dimethyl-4,5-dihydropurine-2,6-dione has a molecular weight of 322.11 g/mol, XLogP of -0.06, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(iodomethyl)-1,3-dimethyl-4,5-dihydropurine-2,6-dione is sourced from PubChem (CID 129289619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).