About 4-(2-fluoro-4-methyl-2,3-dihydropyridin-5-yl)-1,3-thiazole
4-(2-fluoro-4-methyl-2,3-dihydropyridin-5-yl)-1,3-thiazole (PubChem CID 129289732) has the molecular formula C9H9FN2S
and a molecular weight of 196.25 g/mol. Its IUPAC name is 4-(2-fluoro-4-methyl-2,3-dihydropyridin-5-yl)-1,3-thiazole.
Molecular Properties
| Compound Name | 4-(2-fluoro-4-methyl-2,3-dihydropyridin-5-yl)-1,3-thiazole |
| PubChem CID | 129289732 |
| Molecular Formula | C9H9FN2S |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 4-(2-fluoro-4-methyl-2,3-dihydropyridin-5-yl)-1,3-thiazole |
| SMILES | CC1=C(c2cscn2)C=NC(F)C1 |
| InChI | InChI=1S/C9H9FN2S/c1-6-2-9(10)11-3-7(6)8-4-13-5-12-8/h3-5,9H,2H2,1H3 |
| InChIKey | JFMDIWOQJLSQJU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-fluoro-4-methyl-2,3-dihydropyridin-5-yl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-fluoro-4-methyl-2,3-dihydropyridin-5-yl)-1,3-thiazole?
The IUPAC name of 4-(2-fluoro-4-methyl-2,3-dihydropyridin-5-yl)-1,3-thiazole (CID 129289732) is 4-(2-fluoro-4-methyl-2,3-dihydropyridin-5-yl)-1,3-thiazole.
What is the SMILES notation for 4-(2-fluoro-4-methyl-2,3-dihydropyridin-5-yl)-1,3-thiazole?
The canonical SMILES for 4-(2-fluoro-4-methyl-2,3-dihydropyridin-5-yl)-1,3-thiazole is CC1=C(c2cscn2)C=NC(F)C1.
What is the InChIKey of 4-(2-fluoro-4-methyl-2,3-dihydropyridin-5-yl)-1,3-thiazole?
The InChIKey is JFMDIWOQJLSQJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FN2S/c1-6-2-9(10)11-3-7(6)8-4-13-5-12-8/h3-5,9H,2H2,1H3.
What are the key properties of 4-(2-fluoro-4-methyl-2,3-dihydropyridin-5-yl)-1,3-thiazole?
4-(2-fluoro-4-methyl-2,3-dihydropyridin-5-yl)-1,3-thiazole has a molecular weight of 196.25 g/mol, XLogP of 2.69, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-fluoro-4-methyl-2,3-dihydropyridin-5-yl)-1,3-thiazole is sourced from PubChem (CID 129289732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).