C6H9N3O3 — CID 129289795
5-(hydroxymethylamino)-1-methylpyrimidine-2,4-dione (PubChem CID 129289795) has the molecular formula C6H9N3O3 and a molecular weight of 171.16 g/mol. Its IUPAC name is 5-(hydroxymethylamino)-1-methylpyrimidine-2,4-dione.
| Compound Name | 5-(hydroxymethylamino)-1-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 129289795 |
| Molecular Formula | C6H9N3O3 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | 5-(hydroxymethylamino)-1-methylpyrimidine-2,4-dione |
| SMILES | Cn1cc(NCO)c(=O)[nH]c1=O |
| InChI | InChI=1S/C6H9N3O3/c1-9-2-4(7-3-10)5(11)8-6(9)12/h2,7,10H,3H2,1H3,(H,8,11,12) |
| InChIKey | DVQPFKAMZYHJGI-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|