About 5-[(Z)-1-amino-2-sulfanylethenyl]cyclohexa-1,5-dien-1-ol
5-[(Z)-1-amino-2-sulfanylethenyl]cyclohexa-1,5-dien-1-ol (PubChem CID 129289813) has the molecular formula C8H11NOS
and a molecular weight of 169.25 g/mol. Its IUPAC name is 5-[(Z)-1-amino-2-sulfanylethenyl]cyclohexa-1,5-dien-1-ol.
Molecular Properties
| Compound Name | 5-[(Z)-1-amino-2-sulfanylethenyl]cyclohexa-1,5-dien-1-ol |
| PubChem CID | 129289813 |
| Molecular Formula | C8H11NOS |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | 5-[(Z)-1-amino-2-sulfanylethenyl]cyclohexa-1,5-dien-1-ol |
| SMILES | N/C(=C\S)C1=CC(O)=CCC1 |
| InChI | InChI=1S/C8H11NOS/c9-8(5-11)6-2-1-3-7(10)4-6/h3-5,10-11H,1-2,9H2/b8-5- |
| InChIKey | UMBWZZLTLKQJRV-YVMONPNESA-N |
| XLogP | 1.88 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5-[(Z)-1-amino-2-sulfanylethenyl]cyclohexa-1,5-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(Z)-1-amino-2-sulfanylethenyl]cyclohexa-1,5-dien-1-ol?
The IUPAC name of 5-[(Z)-1-amino-2-sulfanylethenyl]cyclohexa-1,5-dien-1-ol (CID 129289813) is 5-[(Z)-1-amino-2-sulfanylethenyl]cyclohexa-1,5-dien-1-ol.
What is the SMILES notation for 5-[(Z)-1-amino-2-sulfanylethenyl]cyclohexa-1,5-dien-1-ol?
The canonical SMILES for 5-[(Z)-1-amino-2-sulfanylethenyl]cyclohexa-1,5-dien-1-ol is N/C(=C\S)C1=CC(O)=CCC1.
What is the InChIKey of 5-[(Z)-1-amino-2-sulfanylethenyl]cyclohexa-1,5-dien-1-ol?
The InChIKey is UMBWZZLTLKQJRV-YVMONPNESA-N. The full InChI is InChI=1S/C8H11NOS/c9-8(5-11)6-2-1-3-7(10)4-6/h3-5,10-11H,1-2,9H2/b8-5-.
What are the key properties of 5-[(Z)-1-amino-2-sulfanylethenyl]cyclohexa-1,5-dien-1-ol?
5-[(Z)-1-amino-2-sulfanylethenyl]cyclohexa-1,5-dien-1-ol has a molecular weight of 169.25 g/mol, XLogP of 1.88, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(Z)-1-amino-2-sulfanylethenyl]cyclohexa-1,5-dien-1-ol is sourced from PubChem (CID 129289813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).