C18H24N2 — CID 129291272
1-N,1-N'-bis(2-ethylphenyl)ethane-1,1-diamine (PubChem CID 129291272) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 1-N,1-N'-bis(2-ethylphenyl)ethane-1,1-diamine.
| Compound Name | 1-N,1-N'-bis(2-ethylphenyl)ethane-1,1-diamine |
|---|---|
| PubChem CID | 129291272 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 1-N,1-N'-bis(2-ethylphenyl)ethane-1,1-diamine |
| SMILES | CCc1ccccc1NC(C)Nc1ccccc1CC |
| InChI | InChI=1S/C18H24N2/c1-4-15-10-6-8-12-17(15)19-14(3)20-18-13-9-7-11-16(18)5-2/h6-14,19-20H,4-5H2,1-3H3 |
| InChIKey | VWDZBSMBEBREJA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|