C28H31N2P — CID 129291277
N'-[cyclohexa-1,5-dien-1-yl(phenyl)phosphanyl]-N-(2,6-dimethylphenyl)-1-(4-methylphenyl)methanediamine (PubChem CID 129291277) has the molecular formula C28H31N2P and a molecular weight of 426.54 g/mol. Its IUPAC name is N'-[cyclohexa-1,5-dien-1-yl(phenyl)phosphanyl]-N-(2,6-dimethylphenyl)-1-(4-methylphenyl)methanediamine.
| Compound Name | N'-[cyclohexa-1,5-dien-1-yl(phenyl)phosphanyl]-N-(2,6-dimethylphenyl)-1-(4-methylphenyl)methanediamine |
|---|---|
| PubChem CID | 129291277 |
| Molecular Formula | C28H31N2P |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | N'-[cyclohexa-1,5-dien-1-yl(phenyl)phosphanyl]-N-(2,6-dimethylphenyl)-1-(4-methylphenyl)methanediamine |
| SMILES | Cc1ccc(C(Nc2c(C)cccc2C)NP(C2=CCCC=C2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H31N2P/c1-21-17-19-24(20-18-21)28(29-27-22(2)11-10-12-23(27)3)30-31(25-13-6-4-7-14-25)26-15-8-5-9-16-26/h4,6-8,10-20,28-30H,5,9H2,1-3H3 |
| InChIKey | IZPUKGQIFFEPAL-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|