C7H11F6NO — CID 129291505
2,2,4,4,6,6-hexafluoro-6-methoxyhexan-1-amine (PubChem CID 129291505) has the molecular formula C7H11F6NO and a molecular weight of 239.16 g/mol. Its IUPAC name is 2,2,4,4,6,6-hexafluoro-6-methoxyhexan-1-amine.
| Compound Name | 2,2,4,4,6,6-hexafluoro-6-methoxyhexan-1-amine |
|---|---|
| PubChem CID | 129291505 |
| Molecular Formula | C7H11F6NO |
| Molecular Weight | 239.16 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 2,2,4,4,6,6-hexafluoro-6-methoxyhexan-1-amine |
| SMILES | COC(F)(F)CC(F)(F)CC(F)(F)CN |
| InChI | InChI=1S/C7H11F6NO/c1-15-7(12,13)3-5(8,9)2-6(10,11)4-14/h2-4,14H2,1H3 |
| InChIKey | UQOANNWTAJVKEB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.16 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |