C62H38N12OS — CID 129291700
10-[3-[3,5-bis(4,6-dipyridin-2-yl-1,3,5-triazin-2-yl)phenyl]-5-phenothiazin-10-ylphenyl]phenoxazine (PubChem CID 129291700) has the molecular formula C62H38N12OS and a molecular weight of 999.14 g/mol. Its IUPAC name is 10-[3-[3,5-bis(4,6-dipyridin-2-yl-1,3,5-triazin-2-yl)phenyl]-5-phenothiazin-10-ylphenyl]phenoxazine.
| Compound Name | 10-[3-[3,5-bis(4,6-dipyridin-2-yl-1,3,5-triazin-2-yl)phenyl]-5-phenothiazin-10-ylphenyl]phenoxazine |
|---|---|
| PubChem CID | 129291700 |
| Molecular Formula | C62H38N12OS |
| Molecular Weight | 999.14 g/mol |
| Exact Mass | 998.30 |
| IUPAC Name | 10-[3-[3,5-bis(4,6-dipyridin-2-yl-1,3,5-triazin-2-yl)phenyl]-5-phenothiazin-10-ylphenyl]phenoxazine |
| SMILES | c1ccc(-c2nc(-c3cc(-c4cc(N5c6ccccc6Oc6ccccc65)cc(N5c6ccccc6Sc6ccccc65)c4)cc(-c4nc(-c5ccccn5)nc(-c5ccccn5)n4)c3)nc(-c3ccccn3)n2)nc1 |
| InChI | InChI=1S/C62H38N12OS/c1-5-25-53-49(21-1)73(50-22-2-6-26-54(50)75-53)43-36-40(37-44(38-43)74-51-23-3-7-27-55(51)76-56-28-8-4-24-52(56)74)39-33-41(57-67-59(45-17-9-13-29-63-45)71-60(68-57)46-18-10-14-30-64-46)35-42(34-39)58-69-61(47-19-11-15-31-65-47)72-62(70-58)48-20-12-16-32-66-48/h1-38H |
| InChIKey | RNXPETQIZMSSJQ-UHFFFAOYSA-N |
| XLogP | 14.82 |
| TPSA | 144.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 999.14 |
| LogP ≤ 5 | 14.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |