C15H28N2 — CID 129292090
1-[(4Z,6Z)-6-ethylocta-4,6-dien-2-yl]-2-[(E)-pent-2-en-3-yl]hydrazine (PubChem CID 129292090) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is 1-[(4Z,6Z)-6-ethylocta-4,6-dien-2-yl]-2-[(E)-pent-2-en-3-yl]hydrazine.
| Compound Name | 1-[(4Z,6Z)-6-ethylocta-4,6-dien-2-yl]-2-[(E)-pent-2-en-3-yl]hydrazine |
|---|---|
| PubChem CID | 129292090 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | 1-[(4Z,6Z)-6-ethylocta-4,6-dien-2-yl]-2-[(E)-pent-2-en-3-yl]hydrazine |
| SMILES | C/C=C(\C=C/CC(C)NN/C(=C/C)CC)CC |
| InChI | InChI=1S/C15H28N2/c1-6-14(7-2)12-10-11-13(5)16-17-15(8-3)9-4/h6,8,10,12-13,16-17H,7,9,11H2,1-5H3/b12-10-,14-6-,15-8+ |
| InChIKey | YGTLAEILNDGBFQ-MTMFYFRWSA-N |
| XLogP | 4.09 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|